C17H34O7S2 — CID 89331020
4-[5-(2,3-dihydroxypropylsulfanyl)-2,2,3,5-tetramethylhexan-3-yl]oxy-4-oxobutane-1-sulfonic acid (PubChem CID 89331020) has the molecular formula C17H34O7S2 and a molecular weight of 414.59 g/mol. Its IUPAC name is 4-[5-(2,3-dihydroxypropylsulfanyl)-2,2,3,5-tetramethylhexan-3-yl]oxy-4-oxobutane-1-sulfonic acid.
| Compound Name | 4-[5-(2,3-dihydroxypropylsulfanyl)-2,2,3,5-tetramethylhexan-3-yl]oxy-4-oxobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 89331020 |
| Molecular Formula | C17H34O7S2 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 4-[5-(2,3-dihydroxypropylsulfanyl)-2,2,3,5-tetramethylhexan-3-yl]oxy-4-oxobutane-1-sulfonic acid |
| SMILES | CC(C)(CC(C)(OC(=O)CCCS(=O)(=O)O)C(C)(C)C)SCC(O)CO |
| InChI | InChI=1S/C17H34O7S2/c1-15(2,3)17(6,12-16(4,5)25-11-13(19)10-18)24-14(20)8-7-9-26(21,22)23/h13,18-19H,7-12H2,1-6H3,(H,21,22,23) |
| InChIKey | MLWOBJHPIJTARX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|