C18H32O4 — CID 89150904
[3-oxo-3-(2,2,3,5,5-pentamethylhexan-3-yloxy)propyl] 2-methylprop-2-enoate (PubChem CID 89150904) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is [3-oxo-3-(2,2,3,5,5-pentamethylhexan-3-yloxy)propyl] 2-methylprop-2-enoate.
| Compound Name | [3-oxo-3-(2,2,3,5,5-pentamethylhexan-3-yloxy)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89150904 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | [3-oxo-3-(2,2,3,5,5-pentamethylhexan-3-yloxy)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(=O)OC(C)(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H32O4/c1-13(2)15(20)21-11-10-14(19)22-18(9,17(6,7)8)12-16(3,4)5/h1,10-12H2,2-9H3 |
| InChIKey | DATVCWWTHKLFJP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|