C15H24O6S — CID 20643723
[3-[3-(2-methyl-1-methylsulfanylpropan-2-yl)oxy-3-oxopropoxy]-3-oxopropyl] 2-methylprop-2-enoate (PubChem CID 20643723) has the molecular formula C15H24O6S and a molecular weight of 332.42 g/mol. Its IUPAC name is [3-[3-(2-methyl-1-methylsulfanylpropan-2-yl)oxy-3-oxopropoxy]-3-oxopropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[3-(2-methyl-1-methylsulfanylpropan-2-yl)oxy-3-oxopropoxy]-3-oxopropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 20643723 |
| Molecular Formula | C15H24O6S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | [3-[3-(2-methyl-1-methylsulfanylpropan-2-yl)oxy-3-oxopropoxy]-3-oxopropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(=O)OCCC(=O)OC(C)(C)CSC |
| InChI | InChI=1S/C15H24O6S/c1-11(2)14(18)20-9-6-12(16)19-8-7-13(17)21-15(3,4)10-22-5/h1,6-10H2,2-5H3 |
| InChIKey | IQGRLRGEIWJAJW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|