C13H21ClO5 — CID 20643741
2-[3-(1-chloro-2-methylpropan-2-yl)oxy-3-oxopropoxy]ethyl 2-methylprop-2-enoate (PubChem CID 20643741) has the molecular formula C13H21ClO5 and a molecular weight of 292.76 g/mol. Its IUPAC name is 2-[3-(1-chloro-2-methylpropan-2-yl)oxy-3-oxopropoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3-(1-chloro-2-methylpropan-2-yl)oxy-3-oxopropoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 20643741 |
| Molecular Formula | C13H21ClO5 |
| Molecular Weight | 292.76 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-[3-(1-chloro-2-methylpropan-2-yl)oxy-3-oxopropoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCC(=O)OC(C)(C)CCl |
| InChI | InChI=1S/C13H21ClO5/c1-10(2)12(16)18-8-7-17-6-5-11(15)19-13(3,4)9-14/h1,5-9H2,2-4H3 |
| InChIKey | BSFMLPRRGNZMKE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.76 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|