C10H20O5S2 — CID 159952100
6-(2-hydroxyethylsulfanyl)-2,2-dimethyl-4-oxohexane-1-sulfonic acid (PubChem CID 159952100) has the molecular formula C10H20O5S2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 6-(2-hydroxyethylsulfanyl)-2,2-dimethyl-4-oxohexane-1-sulfonic acid.
| Compound Name | 6-(2-hydroxyethylsulfanyl)-2,2-dimethyl-4-oxohexane-1-sulfonic acid |
|---|---|
| PubChem CID | 159952100 |
| Molecular Formula | C10H20O5S2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 6-(2-hydroxyethylsulfanyl)-2,2-dimethyl-4-oxohexane-1-sulfonic acid |
| SMILES | CC(C)(CC(=O)CCSCCO)CS(=O)(=O)O |
| InChI | InChI=1S/C10H20O5S2/c1-10(2,8-17(13,14)15)7-9(12)3-5-16-6-4-11/h11H,3-8H2,1-2H3,(H,13,14,15) |
| InChIKey | JESHBBHQYBYFQH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|