C32H33N5O2 — CID 10673520
1-[2-(4-benzhydrylpiperazin-1-yl)ethyl]-3-(imidazol-1-ylmethyl)indole-6-carboxylic acid (PubChem CID 10673520) has the molecular formula C32H33N5O2 and a molecular weight of 519.65 g/mol. Its IUPAC name is 1-[2-(4-benzhydrylpiperazin-1-yl)ethyl]-3-(imidazol-1-ylmethyl)indole-6-carboxylic acid.
| Compound Name | 1-[2-(4-benzhydrylpiperazin-1-yl)ethyl]-3-(imidazol-1-ylmethyl)indole-6-carboxylic acid |
|---|---|
| PubChem CID | 10673520 |
| Molecular Formula | C32H33N5O2 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 1-[2-(4-benzhydrylpiperazin-1-yl)ethyl]-3-(imidazol-1-ylmethyl)indole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(Cn3ccnc3)cn(CCN3CCN(C(c4ccccc4)c4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C32H33N5O2/c38-32(39)27-11-12-29-28(22-35-14-13-33-24-35)23-37(30(29)21-27)20-17-34-15-18-36(19-16-34)31(25-7-3-1-4-8-25)26-9-5-2-6-10-26/h1-14,21,23-24,31H,15-20,22H2,(H,38,39) |
| InChIKey | NMDWIUCUCHILCO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |