C9H15F3N2O — CID 106737372
N-(2-amino-1-cyclopentylethyl)-2,2,2-trifluoroacetamide (PubChem CID 106737372) has the molecular formula C9H15F3N2O and a molecular weight of 224.23 g/mol. Its IUPAC name is N-(2-amino-1-cyclopentylethyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(2-amino-1-cyclopentylethyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 106737372 |
| Molecular Formula | C9H15F3N2O |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | N-(2-amino-1-cyclopentylethyl)-2,2,2-trifluoroacetamide |
| SMILES | NCC(NC(=O)C(F)(F)F)C1CCCC1 |
| InChI | InChI=1S/C9H15F3N2O/c10-9(11,12)8(15)14-7(5-13)6-3-1-2-4-6/h6-7H,1-5,13H2,(H,14,15) |
| InChIKey | DPHOUZFUKNJHMV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |