C10H16N2O — CID 106738666
2-methyl-N-prop-2-ynylpiperidine-4-carboxamide (PubChem CID 106738666) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-methyl-N-prop-2-ynylpiperidine-4-carboxamide.
| Compound Name | 2-methyl-N-prop-2-ynylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 106738666 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-methyl-N-prop-2-ynylpiperidine-4-carboxamide |
| SMILES | C#CCNC(=O)C1CCNC(C)C1 |
| InChI | InChI=1S/C10H16N2O/c1-3-5-12-10(13)9-4-6-11-8(2)7-9/h1,8-9,11H,4-7H2,2H3,(H,12,13) |
| InChIKey | UAIZCWJSJGFDTH-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|