C13H21N3O3 — CID 106740243
3,3-dimethyl-4-(2-methylpiperidine-4-carbonyl)piperazine-2,6-dione (PubChem CID 106740243) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 3,3-dimethyl-4-(2-methylpiperidine-4-carbonyl)piperazine-2,6-dione.
| Compound Name | 3,3-dimethyl-4-(2-methylpiperidine-4-carbonyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 106740243 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 3,3-dimethyl-4-(2-methylpiperidine-4-carbonyl)piperazine-2,6-dione |
| SMILES | CC1CC(C(=O)N2CC(=O)NC(=O)C2(C)C)CCN1 |
| InChI | InChI=1S/C13H21N3O3/c1-8-6-9(4-5-14-8)11(18)16-7-10(17)15-12(19)13(16,2)3/h8-9,14H,4-7H2,1-3H3,(H,15,17,19) |
| InChIKey | VXVPHERKJPGPQQ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|