C9H12N2O5 — CID 112617395
methyl 2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-2-oxoacetate (PubChem CID 112617395) has the molecular formula C9H12N2O5 and a molecular weight of 228.20 g/mol. Its IUPAC name is methyl 2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-2-oxoacetate.
| Compound Name | methyl 2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 112617395 |
| Molecular Formula | C9H12N2O5 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | methyl 2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-2-oxoacetate |
| SMILES | COC(=O)C(=O)N1CC(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C9H12N2O5/c1-9(2)8(15)10-5(12)4-11(9)6(13)7(14)16-3/h4H2,1-3H3,(H,10,12,15) |
| InChIKey | MOTHHATXTRHAEO-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|