C8H12N4O4 — CID 66067870
2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-2-oxoacetohydrazide (PubChem CID 66067870) has the molecular formula C8H12N4O4 and a molecular weight of 228.21 g/mol. Its IUPAC name is 2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-2-oxoacetohydrazide.
| Compound Name | 2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-2-oxoacetohydrazide |
|---|---|
| PubChem CID | 66067870 |
| Molecular Formula | C8H12N4O4 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-2-oxoacetohydrazide |
| SMILES | CC1(C)C(=O)NC(=O)CN1C(=O)C(=O)NN |
| InChI | InChI=1S/C8H12N4O4/c1-8(2)7(16)10-4(13)3-12(8)6(15)5(14)11-9/h3,9H2,1-2H3,(H,11,14)(H,10,13,16) |
| InChIKey | YIADCUWDDYLHFA-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|