C9H12F3N3O3 — CID 113463021
2,2-dimethyl-3,5-dioxo-N-(2,2,2-trifluoroethyl)piperazine-1-carboxamide (PubChem CID 113463021) has the molecular formula C9H12F3N3O3 and a molecular weight of 267.21 g/mol. Its IUPAC name is 2,2-dimethyl-3,5-dioxo-N-(2,2,2-trifluoroethyl)piperazine-1-carboxamide.
| Compound Name | 2,2-dimethyl-3,5-dioxo-N-(2,2,2-trifluoroethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113463021 |
| Molecular Formula | C9H12F3N3O3 |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2,2-dimethyl-3,5-dioxo-N-(2,2,2-trifluoroethyl)piperazine-1-carboxamide |
| SMILES | CC1(C)C(=O)NC(=O)CN1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H12F3N3O3/c1-8(2)6(17)14-5(16)3-15(8)7(18)13-4-9(10,11)12/h3-4H2,1-2H3,(H,13,18)(H,14,16,17) |
| InChIKey | NUUQCRGMJRCRBZ-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|