C10H15N3O6 — CID 66076379
2-[(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)amino]-3-hydroxypropanoic acid (PubChem CID 66076379) has the molecular formula C10H15N3O6 and a molecular weight of 273.25 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 66076379 |
| Molecular Formula | C10H15N3O6 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-[(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)amino]-3-hydroxypropanoic acid |
| SMILES | CC1(C)C(=O)NC(=O)CN1C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C10H15N3O6/c1-10(2)8(18)12-6(15)3-13(10)9(19)11-5(4-14)7(16)17/h5,14H,3-4H2,1-2H3,(H,11,19)(H,16,17)(H,12,15,18) |
| InChIKey | STTJBBLMGWYRNI-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|