C11H17N3O6 — CID 107840352
4-[(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)amino]-2-hydroxybutanoic acid (PubChem CID 107840352) has the molecular formula C11H17N3O6 and a molecular weight of 287.27 g/mol. Its IUPAC name is 4-[(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)amino]-2-hydroxybutanoic acid.
| Compound Name | 4-[(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)amino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107840352 |
| Molecular Formula | C11H17N3O6 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 4-[(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)amino]-2-hydroxybutanoic acid |
| SMILES | CC1(C)C(=O)NC(=O)CN1C(=O)NCCC(O)C(=O)O |
| InChI | InChI=1S/C11H17N3O6/c1-11(2)9(19)13-7(16)5-14(11)10(20)12-4-3-6(15)8(17)18/h6,15H,3-5H2,1-2H3,(H,12,20)(H,17,18)(H,13,16,19) |
| InChIKey | CHAMUBNONLKKDP-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|