C11H19N3O2S — CID 116509226
2,2-dimethyl-N-(2-methylpropyl)-3,5-dioxopiperazine-1-carbothioamide (PubChem CID 116509226) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is 2,2-dimethyl-N-(2-methylpropyl)-3,5-dioxopiperazine-1-carbothioamide.
| Compound Name | 2,2-dimethyl-N-(2-methylpropyl)-3,5-dioxopiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 116509226 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2,2-dimethyl-N-(2-methylpropyl)-3,5-dioxopiperazine-1-carbothioamide |
| SMILES | CC(C)CNC(=S)N1CC(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C11H19N3O2S/c1-7(2)5-12-10(17)14-6-8(15)13-9(16)11(14,3)4/h7H,5-6H2,1-4H3,(H,12,17)(H,13,15,16) |
| InChIKey | LHBAAIYKNDBVPH-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|