C12H19N3O5 — CID 66062218
6-[(3,5-dioxopiperazine-1-carbonyl)amino]-4-methylhexanoic acid (PubChem CID 66062218) has the molecular formula C12H19N3O5 and a molecular weight of 285.30 g/mol. Its IUPAC name is 6-[(3,5-dioxopiperazine-1-carbonyl)amino]-4-methylhexanoic acid.
| Compound Name | 6-[(3,5-dioxopiperazine-1-carbonyl)amino]-4-methylhexanoic acid |
|---|---|
| PubChem CID | 66062218 |
| Molecular Formula | C12H19N3O5 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 6-[(3,5-dioxopiperazine-1-carbonyl)amino]-4-methylhexanoic acid |
| SMILES | CC(CCNC(=O)N1CC(=O)NC(=O)C1)CCC(=O)O |
| InChI | InChI=1S/C12H19N3O5/c1-8(2-3-11(18)19)4-5-13-12(20)15-6-9(16)14-10(17)7-15/h8H,2-7H2,1H3,(H,13,20)(H,18,19)(H,14,16,17) |
| InChIKey | UIXXCWSZVNEQLA-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|