C13H13Cl2N3O3 — CID 107653959
N-(3,5-dichlorophenyl)-2,2-dimethyl-3,5-dioxopiperazine-1-carboxamide (PubChem CID 107653959) has the molecular formula C13H13Cl2N3O3 and a molecular weight of 330.17 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2,2-dimethyl-3,5-dioxopiperazine-1-carboxamide.
| Compound Name | N-(3,5-dichlorophenyl)-2,2-dimethyl-3,5-dioxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 107653959 |
| Molecular Formula | C13H13Cl2N3O3 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2,2-dimethyl-3,5-dioxopiperazine-1-carboxamide |
| SMILES | CC1(C)C(=O)NC(=O)CN1C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H13Cl2N3O3/c1-13(2)11(20)17-10(19)6-18(13)12(21)16-9-4-7(14)3-8(15)5-9/h3-5H,6H2,1-2H3,(H,16,21)(H,17,19,20) |
| InChIKey | BXFIKBNPOYKQCO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|