C12H13Cl2N3OS — CID 134103003
N-(3,5-dichlorophenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide (PubChem CID 134103003) has the molecular formula C12H13Cl2N3OS and a molecular weight of 318.23 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide.
| Compound Name | N-(3,5-dichlorophenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide |
|---|---|
| PubChem CID | 134103003 |
| Molecular Formula | C12H13Cl2N3OS |
| Molecular Weight | 318.23 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | N-(3,5-dichlorophenyl)-4,4-dimethyl-2-sulfanylideneimidazolidine-1-carboxamide |
| SMILES | CC1(C)CN(C(=O)Nc2cc(Cl)cc(Cl)c2)C(=S)N1 |
| InChI | InChI=1S/C12H13Cl2N3OS/c1-12(2)6-17(11(19)16-12)10(18)15-9-4-7(13)3-8(14)5-9/h3-5H,6H2,1-2H3,(H,15,18)(H,16,19) |
| InChIKey | DCRRWDSWDSVSRT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.23 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|