C15H22Cl2N2O — CID 5194568
1,1-dibutyl-3-(3,5-dichlorophenyl)urea (PubChem CID 5194568) has the molecular formula C15H22Cl2N2O and a molecular weight of 317.26 g/mol. Its IUPAC name is 1,1-dibutyl-3-(3,5-dichlorophenyl)urea.
| Compound Name | 1,1-dibutyl-3-(3,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 5194568 |
| Molecular Formula | C15H22Cl2N2O |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 1,1-dibutyl-3-(3,5-dichlorophenyl)urea |
| SMILES | CCCCN(CCCC)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H22Cl2N2O/c1-3-5-7-19(8-6-4-2)15(20)18-14-10-12(16)9-13(17)11-14/h9-11H,3-8H2,1-2H3,(H,18,20) |
| InChIKey | XYOUIZSNPKALSK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |