About Monuron
Monuron (PubChem CID 8800) has the molecular formula C9H11ClN2O
and a molecular weight of 198.65 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1,1-dimethylurea.
Molecular Properties
| Compound Name | Monuron |
| PubChem CID | 8800 |
| Molecular Formula | C9H11ClN2O |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 3-(4-chlorophenyl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC1=CC=C(C=C1)Cl |
| InChI | InChI=1S/C9H11ClN2O/c1-12(2)9(13)11-8-5-3-7(10)4-6-8/h3-6H,1-2H3,(H,11,13) |
| InChIKey | BMLIZLVNXIYGCK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 32.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | 176 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Monuron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Monuron?
The IUPAC name of Monuron (CID 8800) is 3-(4-chlorophenyl)-1,1-dimethylurea.
What is the SMILES notation for Monuron?
The canonical SMILES for Monuron is CN(C)C(=O)NC1=CC=C(C=C1)Cl.
What is the InChIKey of Monuron?
The InChIKey is BMLIZLVNXIYGCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClN2O/c1-12(2)9(13)11-8-5-3-7(10)4-6-8/h3-6H,1-2H3,(H,11,13).
What are the key properties of Monuron?
Monuron has a molecular weight of 198.65 g/mol, XLogP of 1.90, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Monuron is sourced from PubChem (CID 8800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).