C11H12Cl4N2O3 — CID 8799
3-(4-chlorophenyl)-1,1-dimethylurea;2,2,2-trichloroacetic acid (PubChem CID 8799) has the molecular formula C11H12Cl4N2O3 and a molecular weight of 362.04 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1,1-dimethylurea;2,2,2-trichloroacetic acid.
| Compound Name | 3-(4-chlorophenyl)-1,1-dimethylurea;2,2,2-trichloroacetic acid |
|---|---|
| PubChem CID | 8799 |
| Molecular Formula | C11H12Cl4N2O3 |
| Molecular Weight | 362.04 g/mol |
| Exact Mass | 359.96 |
| IUPAC Name | 3-(4-chlorophenyl)-1,1-dimethylurea;2,2,2-trichloroacetic acid |
| SMILES | CN(C)C(=O)Nc1ccc(Cl)cc1.O=C(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H11ClN2O.C2HCl3O2/c1-12(2)9(13)11-8-5-3-7(10)4-6-8;3-2(4,5)1(6)7/h3-6H,1-2H3,(H,11,13);(H,6,7) |
| InChIKey | DUQGREMIROGTTD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.04 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|