3-(4-chlorophenyl)-1,1-dimethylurea;2,2,2-trichloroacetic acid

C11H12Cl4N2O3 — CID 8799

IUPAC3-(4-chlorophenyl)-1,1-dimethylurea;2,2,2-trichloroacetic acid
SMILESCN(C)C(=O)Nc1ccc(Cl)cc1.O=C(O)C(Cl)(Cl)Cl
InChIInChI=1S/C9H11ClN2O.C2HCl3O2/c1-12(2)9(13)11-8-5-3-7(10)4-6-8;3-2(4,5)1(6)7/h3-6H,1-2H3,(H,11,13);(H,6,7)
InChIKeyDUQGREMIROGTTD-UHFFFAOYSA-N
MW362.04 g/mol
LogP3.87
Rot. Bonds1

About 3-(4-chlorophenyl)-1,1-dimethylurea;2,2,2-trichloroacetic acid

3-(4-chlorophenyl)-1,1-dimethylurea;2,2,2-trichloroacetic acid (PubChem CID 8799) has the molecular formula C11H12Cl4N2O3 and a molecular weight of 362.04 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1,1-dimethylurea;2,2,2-trichloroacetic acid.

Molecular Properties

Compound Name3-(4-chlorophenyl)-1,1-dimethylurea;2,2,2-trichloroacetic acid
PubChem CID8799
Molecular FormulaC11H12Cl4N2O3
Molecular Weight362.04 g/mol
Exact Mass359.96
IUPAC Name3-(4-chlorophenyl)-1,1-dimethylurea;2,2,2-trichloroacetic acid
SMILESCN(C)C(=O)Nc1ccc(Cl)cc1.O=C(O)C(Cl)(Cl)Cl
InChIInChI=1S/C9H11ClN2O.C2HCl3O2/c1-12(2)9(13)11-8-5-3-7(10)4-6-8;3-2(4,5)1(6)7/h3-6H,1-2H3,(H,11,13);(H,6,7)
InChIKeyDUQGREMIROGTTD-UHFFFAOYSA-N
XLogP3.87
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500362.04
LogP ≤ 53.87
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 3-(4-chlorophenyl)-1,1-dimethylurea;2,2,2-trichloroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-chlorophenyl)-1,1-dimethylurea;2,2,2-trichloroacetic acid?
The IUPAC name of 3-(4-chlorophenyl)-1,1-dimethylurea;2,2,2-trichloroacetic acid (CID 8799) is 3-(4-chlorophenyl)-1,1-dimethylurea;2,2,2-trichloroacetic acid.
What is the SMILES notation for 3-(4-chlorophenyl)-1,1-dimethylurea;2,2,2-trichloroacetic acid?
The canonical SMILES for 3-(4-chlorophenyl)-1,1-dimethylurea;2,2,2-trichloroacetic acid is CN(C)C(=O)Nc1ccc(Cl)cc1.O=C(O)C(Cl)(Cl)Cl.
What is the InChIKey of 3-(4-chlorophenyl)-1,1-dimethylurea;2,2,2-trichloroacetic acid?
The InChIKey is DUQGREMIROGTTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClN2O.C2HCl3O2/c1-12(2)9(13)11-8-5-3-7(10)4-6-8;3-2(4,5)1(6)7/h3-6H,1-2H3,(H,11,13);(H,6,7).
What are the key properties of 3-(4-chlorophenyl)-1,1-dimethylurea;2,2,2-trichloroacetic acid?
3-(4-chlorophenyl)-1,1-dimethylurea;2,2,2-trichloroacetic acid has a molecular weight of 362.04 g/mol, XLogP of 3.87, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-1,1-dimethylurea;2,2,2-trichloroacetic acid is sourced from PubChem (CID 8799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).