C7H6Cl2N2O — CID 4165004
(3,5-dichlorophenyl)urea (PubChem CID 4165004) has the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. Its IUPAC name is (3,5-dichlorophenyl)urea.
| Compound Name | (3,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 4165004 |
| Molecular Formula | C7H6Cl2N2O |
| Molecular Weight | 205.04 g/mol |
| Exact Mass | 203.99 |
| IUPAC Name | (3,5-dichlorophenyl)urea |
| SMILES | NC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C7H6Cl2N2O/c8-4-1-5(9)3-6(2-4)11-7(10)12/h1-3H,(H3,10,11,12) |
| InChIKey | FTJBMYITMFAUCP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.04 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |