C13H11Cl2IN2O3 — CID 66075733
4-(3,5-dichloro-2-iodobenzoyl)-3,3-dimethylpiperazine-2,6-dione (PubChem CID 66075733) has the molecular formula C13H11Cl2IN2O3 and a molecular weight of 441.05 g/mol. Its IUPAC name is 4-(3,5-dichloro-2-iodobenzoyl)-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 4-(3,5-dichloro-2-iodobenzoyl)-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66075733 |
| Molecular Formula | C13H11Cl2IN2O3 |
| Molecular Weight | 441.05 g/mol |
| Exact Mass | 439.92 |
| IUPAC Name | 4-(3,5-dichloro-2-iodobenzoyl)-3,3-dimethylpiperazine-2,6-dione |
| SMILES | CC1(C)C(=O)NC(=O)CN1C(=O)c1cc(Cl)cc(Cl)c1I |
| InChI | InChI=1S/C13H11Cl2IN2O3/c1-13(2)12(21)17-9(19)5-18(13)11(20)7-3-6(14)4-8(15)10(7)16/h3-4H,5H2,1-2H3,(H,17,19,21) |
| InChIKey | URYLUVNBHZABRK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.05 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|