C7H9F3N2O4S — CID 66075966
3,3-dimethyl-4-(trifluoromethylsulfonyl)piperazine-2,6-dione (PubChem CID 66075966) has the molecular formula C7H9F3N2O4S and a molecular weight of 274.22 g/mol. Its IUPAC name is 3,3-dimethyl-4-(trifluoromethylsulfonyl)piperazine-2,6-dione.
| Compound Name | 3,3-dimethyl-4-(trifluoromethylsulfonyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 66075966 |
| Molecular Formula | C7H9F3N2O4S |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 3,3-dimethyl-4-(trifluoromethylsulfonyl)piperazine-2,6-dione |
| SMILES | CC1(C)C(=O)NC(=O)CN1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H9F3N2O4S/c1-6(2)5(14)11-4(13)3-12(6)17(15,16)7(8,9)10/h3H2,1-2H3,(H,11,13,14) |
| InChIKey | IOCIJVSBNGCVQR-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|