C11H12N2O6S2 — CID 66075128
5-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)sulfonylthiophene-3-carboxylic acid (PubChem CID 66075128) has the molecular formula C11H12N2O6S2 and a molecular weight of 332.36 g/mol. Its IUPAC name is 5-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)sulfonylthiophene-3-carboxylic acid.
| Compound Name | 5-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)sulfonylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 66075128 |
| Molecular Formula | C11H12N2O6S2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 5-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)sulfonylthiophene-3-carboxylic acid |
| SMILES | CC1(C)C(=O)NC(=O)CN1S(=O)(=O)c1cc(C(=O)O)cs1 |
| InChI | InChI=1S/C11H12N2O6S2/c1-11(2)10(17)12-7(14)4-13(11)21(18,19)8-3-6(5-20-8)9(15)16/h3,5H,4H2,1-2H3,(H,15,16)(H,12,14,17) |
| InChIKey | CWRXYDJWECRCIW-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|