C9H11NO5S2 — CID 62943561
5-(3-hydroxypyrrolidin-1-yl)sulfonylthiophene-3-carboxylic acid (PubChem CID 62943561) has the molecular formula C9H11NO5S2 and a molecular weight of 277.32 g/mol. Its IUPAC name is 5-(3-hydroxypyrrolidin-1-yl)sulfonylthiophene-3-carboxylic acid.
| Compound Name | 5-(3-hydroxypyrrolidin-1-yl)sulfonylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 62943561 |
| Molecular Formula | C9H11NO5S2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 5-(3-hydroxypyrrolidin-1-yl)sulfonylthiophene-3-carboxylic acid |
| SMILES | O=C(O)c1csc(S(=O)(=O)N2CCC(O)C2)c1 |
| InChI | InChI=1S/C9H11NO5S2/c11-7-1-2-10(4-7)17(14,15)8-3-6(5-16-8)9(12)13/h3,5,7,11H,1-2,4H2,(H,12,13) |
| InChIKey | INOKIJPTKBTMPL-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |