C11H12N2O7S — CID 66074935
5-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)sulfonylfuran-2-carboxylic acid (PubChem CID 66074935) has the molecular formula C11H12N2O7S and a molecular weight of 316.29 g/mol. Its IUPAC name is 5-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)sulfonylfuran-2-carboxylic acid.
| Compound Name | 5-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)sulfonylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 66074935 |
| Molecular Formula | C11H12N2O7S |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 5-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)sulfonylfuran-2-carboxylic acid |
| SMILES | CC1(C)C(=O)NC(=O)CN1S(=O)(=O)c1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C11H12N2O7S/c1-11(2)10(17)12-7(14)5-13(11)21(18,19)8-4-3-6(20-8)9(15)16/h3-4H,5H2,1-2H3,(H,15,16)(H,12,14,17) |
| InChIKey | BMMONIBLFWHCJT-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|