C12H14ClN3O4S — CID 66076080
4-(2-amino-4-chlorophenyl)sulfonyl-3,3-dimethylpiperazine-2,6-dione (PubChem CID 66076080) has the molecular formula C12H14ClN3O4S and a molecular weight of 331.78 g/mol. Its IUPAC name is 4-(2-amino-4-chlorophenyl)sulfonyl-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 4-(2-amino-4-chlorophenyl)sulfonyl-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66076080 |
| Molecular Formula | C12H14ClN3O4S |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 4-(2-amino-4-chlorophenyl)sulfonyl-3,3-dimethylpiperazine-2,6-dione |
| SMILES | CC1(C)C(=O)NC(=O)CN1S(=O)(=O)c1ccc(Cl)cc1N |
| InChI | InChI=1S/C12H14ClN3O4S/c1-12(2)11(18)15-10(17)6-16(12)21(19,20)9-4-3-7(13)5-8(9)14/h3-5H,6,14H2,1-2H3,(H,15,17,18) |
| InChIKey | ZSBAGZCJWMZPGC-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|