C33H31NO2Se — CID 10674260
5-hydroxy-3,4,5-triphenyl-1-(5-phenylselanylpentyl)pyrrol-2-one (PubChem CID 10674260) has the molecular formula C33H31NO2Se and a molecular weight of 552.58 g/mol. Its IUPAC name is 5-hydroxy-3,4,5-triphenyl-1-(5-phenylselanylpentyl)pyrrol-2-one.
| Compound Name | 5-hydroxy-3,4,5-triphenyl-1-(5-phenylselanylpentyl)pyrrol-2-one |
|---|---|
| PubChem CID | 10674260 |
| Molecular Formula | C33H31NO2Se |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | 5-hydroxy-3,4,5-triphenyl-1-(5-phenylselanylpentyl)pyrrol-2-one |
| SMILES | O=C1C(c2ccccc2)=C(c2ccccc2)C(O)(c2ccccc2)N1CCCCC[Se]c1ccccc1 |
| InChI | InChI=1S/C33H31NO2Se/c35-32-30(26-16-6-1-7-17-26)31(27-18-8-2-9-19-27)33(36,28-20-10-3-11-21-28)34(32)24-14-5-15-25-37-29-22-12-4-13-23-29/h1-4,6-13,16-23,36H,5,14-15,24-25H2 |
| InChIKey | CSXVRTQIQSJTAV-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|