C14H22N2O5 — CID 106743978
1-(2-methoxycarbonylpyrrolidine-1-carbonyl)-2-methylpiperidine-4-carboxylic acid (PubChem CID 106743978) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is 1-(2-methoxycarbonylpyrrolidine-1-carbonyl)-2-methylpiperidine-4-carboxylic acid.
| Compound Name | 1-(2-methoxycarbonylpyrrolidine-1-carbonyl)-2-methylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 106743978 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 1-(2-methoxycarbonylpyrrolidine-1-carbonyl)-2-methylpiperidine-4-carboxylic acid |
| SMILES | COC(=O)C1CCCN1C(=O)N1CCC(C(=O)O)CC1C |
| InChI | InChI=1S/C14H22N2O5/c1-9-8-10(12(17)18)5-7-15(9)14(20)16-6-3-4-11(16)13(19)21-2/h9-11H,3-8H2,1-2H3,(H,17,18) |
| InChIKey | PHQGDOSVKHVZIW-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |