C13H22N2O4 — CID 106744628
1-(3-methoxypyrrolidine-1-carbonyl)-2-methylpiperidine-4-carboxylic acid (PubChem CID 106744628) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is 1-(3-methoxypyrrolidine-1-carbonyl)-2-methylpiperidine-4-carboxylic acid.
| Compound Name | 1-(3-methoxypyrrolidine-1-carbonyl)-2-methylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 106744628 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 1-(3-methoxypyrrolidine-1-carbonyl)-2-methylpiperidine-4-carboxylic acid |
| SMILES | COC1CCN(C(=O)N2CCC(C(=O)O)CC2C)C1 |
| InChI | InChI=1S/C13H22N2O4/c1-9-7-10(12(16)17)3-6-15(9)13(18)14-5-4-11(8-14)19-2/h9-11H,3-8H2,1-2H3,(H,16,17) |
| InChIKey | XQRRRTUZRWTJMG-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |