C10H18BF3NO- — CID 106746098
trifluoro-[3-[4-(methoxymethyl)piperidin-1-yl]prop-1-en-2-yl]boranuide (PubChem CID 106746098) has the molecular formula C10H18BF3NO- and a molecular weight of 236.07 g/mol. Its IUPAC name is trifluoro-[3-[4-(methoxymethyl)piperidin-1-yl]prop-1-en-2-yl]boranuide.
| Compound Name | trifluoro-[3-[4-(methoxymethyl)piperidin-1-yl]prop-1-en-2-yl]boranuide |
|---|---|
| PubChem CID | 106746098 |
| Molecular Formula | C10H18BF3NO- |
| Molecular Weight | 236.07 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | trifluoro-[3-[4-(methoxymethyl)piperidin-1-yl]prop-1-en-2-yl]boranuide |
| SMILES | C=C(CN1CCC(COC)CC1)[B-](F)(F)F |
| InChI | InChI=1S/C10H18BF3NO/c1-9(11(12,13)14)7-15-5-3-10(4-6-15)8-16-2/h10H,1,3-8H2,2H3/q-1 |
| InChIKey | NRTJWNQWKBQAFX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.07 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|