C9H11BF3N2O- — CID 106746400
3-(2,4-dimethyl-6-oxopyrimidin-1-yl)prop-1-en-2-yl-trifluoroboranuide (PubChem CID 106746400) has the molecular formula C9H11BF3N2O- and a molecular weight of 231.01 g/mol. Its IUPAC name is 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)prop-1-en-2-yl-trifluoroboranuide.
| Compound Name | 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)prop-1-en-2-yl-trifluoroboranuide |
|---|---|
| PubChem CID | 106746400 |
| Molecular Formula | C9H11BF3N2O- |
| Molecular Weight | 231.01 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 3-(2,4-dimethyl-6-oxopyrimidin-1-yl)prop-1-en-2-yl-trifluoroboranuide |
| SMILES | C=C(Cn1c(C)nc(C)cc1=O)[B-](F)(F)F |
| InChI | InChI=1S/C9H11BF3N2O/c1-6(10(11,12)13)5-15-8(3)14-7(2)4-9(15)16/h4H,1,5H2,2-3H3/q-1 |
| InChIKey | JMOGUKMNGAJUIU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.01 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|