C15H18N2O4 — CID 106748558
4-(3,4,5-trimethoxyphenoxy)benzene-1,2-diamine (PubChem CID 106748558) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 4-(3,4,5-trimethoxyphenoxy)benzene-1,2-diamine.
| Compound Name | 4-(3,4,5-trimethoxyphenoxy)benzene-1,2-diamine |
|---|---|
| PubChem CID | 106748558 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 4-(3,4,5-trimethoxyphenoxy)benzene-1,2-diamine |
| SMILES | COc1cc(Oc2ccc(N)c(N)c2)cc(OC)c1OC |
| InChI | InChI=1S/C15H18N2O4/c1-18-13-7-10(8-14(19-2)15(13)20-3)21-9-4-5-11(16)12(17)6-9/h4-8H,16-17H2,1-3H3 |
| InChIKey | ANFIKPYISOOOCA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|