C12H15F3N2S — CID 106748815
4-(cyclopentylmethylsulfanyl)-6-(trifluoromethyl)pyridin-3-amine (PubChem CID 106748815) has the molecular formula C12H15F3N2S and a molecular weight of 276.33 g/mol. Its IUPAC name is 4-(cyclopentylmethylsulfanyl)-6-(trifluoromethyl)pyridin-3-amine.
| Compound Name | 4-(cyclopentylmethylsulfanyl)-6-(trifluoromethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 106748815 |
| Molecular Formula | C12H15F3N2S |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 4-(cyclopentylmethylsulfanyl)-6-(trifluoromethyl)pyridin-3-amine |
| SMILES | Nc1cnc(C(F)(F)F)cc1SCC1CCCC1 |
| InChI | InChI=1S/C12H15F3N2S/c13-12(14,15)11-5-10(9(16)6-17-11)18-7-8-3-1-2-4-8/h5-6,8H,1-4,7,16H2 |
| InChIKey | NSFGCRVEJWSYRG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |