C16H19N3 — CID 106750204
4-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)benzene-1,2-diamine (PubChem CID 106750204) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is 4-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)benzene-1,2-diamine.
| Compound Name | 4-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 106750204 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 4-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)benzene-1,2-diamine |
| SMILES | Cc1ccc2c(c1)CCCN2c1ccc(N)c(N)c1 |
| InChI | InChI=1S/C16H19N3/c1-11-4-7-16-12(9-11)3-2-8-19(16)13-5-6-14(17)15(18)10-13/h4-7,9-10H,2-3,8,17-18H2,1H3 |
| InChIKey | YTQZIYRXWNOGMS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|