C18H21NO — CID 63370631
(1S)-1-[4-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)phenyl]ethanol (PubChem CID 63370631) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is (1S)-1-[4-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)phenyl]ethanol.
| Compound Name | (1S)-1-[4-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 63370631 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | (1S)-1-[4-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)phenyl]ethanol |
| SMILES | Cc1ccc2c(c1)CCCN2c1ccc([C@H](C)O)cc1 |
| InChI | InChI=1S/C18H21NO/c1-13-5-10-18-16(12-13)4-3-11-19(18)17-8-6-15(7-9-17)14(2)20/h5-10,12,14,20H,3-4,11H2,1-2H3/t14-/m0/s1 |
| InChIKey | OEOGOIPOXKWSFW-AWEZNQCLSA-N |
| XLogP | 4.13 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |