C17H16BrNO2 — CID 102822631
3-bromo-5-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid (PubChem CID 102822631) has the molecular formula C17H16BrNO2 and a molecular weight of 346.22 g/mol. Its IUPAC name is 3-bromo-5-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid.
| Compound Name | 3-bromo-5-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 102822631 |
| Molecular Formula | C17H16BrNO2 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 3-bromo-5-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid |
| SMILES | Cc1ccc2c(c1)CCCN2c1cc(Br)cc(C(=O)O)c1 |
| InChI | InChI=1S/C17H16BrNO2/c1-11-4-5-16-12(7-11)3-2-6-19(16)15-9-13(17(20)21)8-14(18)10-15/h4-5,7-10H,2-3,6H2,1H3,(H,20,21) |
| InChIKey | YQSUILZHSLPVSJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |