About 1-(3-bromo-5-methylphenyl)-6-methoxy-3,4-dihydro-2H-quinoline;carbon dioxide
1-(3-bromo-5-methylphenyl)-6-methoxy-3,4-dihydro-2H-quinoline;carbon dioxide (PubChem CID 161063774) has the molecular formula C18H18BrNO3
and a molecular weight of 376.25 g/mol. Its IUPAC name is 1-(3-bromo-5-methylphenyl)-6-methoxy-3,4-dihydro-2H-quinoline;carbon dioxide.
Molecular Properties
| Compound Name | 1-(3-bromo-5-methylphenyl)-6-methoxy-3,4-dihydro-2H-quinoline;carbon dioxide |
| PubChem CID | 161063774 |
| Molecular Formula | C18H18BrNO3 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 1-(3-bromo-5-methylphenyl)-6-methoxy-3,4-dihydro-2H-quinoline;carbon dioxide |
| SMILES | COc1ccc2c(c1)CCCN2c1cc(C)cc(Br)c1.O=C=O |
| InChI | InChI=1S/C17H18BrNO.CO2/c1-12-8-14(18)11-15(9-12)19-7-3-4-13-10-16(20-2)5-6-17(13)19;2-1-3/h5-6,8-11H,3-4,7H2,1-2H3; |
| InChIKey | UDSXGIVEDHVZBU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-bromo-5-methylphenyl)-6-methoxy-3,4-dihydro-2H-quinoline;carbon dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromo-5-methylphenyl)-6-methoxy-3,4-dihydro-2H-quinoline;carbon dioxide?
The IUPAC name of 1-(3-bromo-5-methylphenyl)-6-methoxy-3,4-dihydro-2H-quinoline;carbon dioxide (CID 161063774) is 1-(3-bromo-5-methylphenyl)-6-methoxy-3,4-dihydro-2H-quinoline;carbon dioxide.
What is the SMILES notation for 1-(3-bromo-5-methylphenyl)-6-methoxy-3,4-dihydro-2H-quinoline;carbon dioxide?
The canonical SMILES for 1-(3-bromo-5-methylphenyl)-6-methoxy-3,4-dihydro-2H-quinoline;carbon dioxide is COc1ccc2c(c1)CCCN2c1cc(C)cc(Br)c1.O=C=O.
What is the InChIKey of 1-(3-bromo-5-methylphenyl)-6-methoxy-3,4-dihydro-2H-quinoline;carbon dioxide?
The InChIKey is UDSXGIVEDHVZBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18BrNO.CO2/c1-12-8-14(18)11-15(9-12)19-7-3-4-13-10-16(20-2)5-6-17(13)19;2-1-3/h5-6,8-11H,3-4,7H2,1-2H3;.
What are the key properties of 1-(3-bromo-5-methylphenyl)-6-methoxy-3,4-dihydro-2H-quinoline;carbon dioxide?
1-(3-bromo-5-methylphenyl)-6-methoxy-3,4-dihydro-2H-quinoline;carbon dioxide has a molecular weight of 376.25 g/mol, XLogP of 4.27, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromo-5-methylphenyl)-6-methoxy-3,4-dihydro-2H-quinoline;carbon dioxide is sourced from PubChem (CID 161063774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).