C14H23N3O — CID 106750915
1-[(3,4-diaminoanilino)methyl]-3-methylcyclohexan-1-ol (PubChem CID 106750915) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-[(3,4-diaminoanilino)methyl]-3-methylcyclohexan-1-ol.
| Compound Name | 1-[(3,4-diaminoanilino)methyl]-3-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 106750915 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 1-[(3,4-diaminoanilino)methyl]-3-methylcyclohexan-1-ol |
| SMILES | CC1CCCC(O)(CNc2ccc(N)c(N)c2)C1 |
| InChI | InChI=1S/C14H23N3O/c1-10-3-2-6-14(18,8-10)9-17-11-4-5-12(15)13(16)7-11/h4-5,7,10,17-18H,2-3,6,8-9,15-16H2,1H3 |
| InChIKey | IRYPPFZTEQSFLL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|