C14H23NO3 — CID 65117347
1-[[[5-(hydroxymethyl)furan-2-yl]methylamino]methyl]-3-methylcyclohexan-1-ol (PubChem CID 65117347) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 1-[[[5-(hydroxymethyl)furan-2-yl]methylamino]methyl]-3-methylcyclohexan-1-ol.
| Compound Name | 1-[[[5-(hydroxymethyl)furan-2-yl]methylamino]methyl]-3-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 65117347 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 1-[[[5-(hydroxymethyl)furan-2-yl]methylamino]methyl]-3-methylcyclohexan-1-ol |
| SMILES | CC1CCCC(O)(CNCc2ccc(CO)o2)C1 |
| InChI | InChI=1S/C14H23NO3/c1-11-3-2-6-14(17,7-11)10-15-8-12-4-5-13(9-16)18-12/h4-5,11,15-17H,2-3,6-10H2,1H3 |
| InChIKey | OBAVTWFUJSYJNE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |