C12H19N3O — CID 106751244
2-[1-(3,4-diaminophenyl)pyrrolidin-3-yl]ethanol (PubChem CID 106751244) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-[1-(3,4-diaminophenyl)pyrrolidin-3-yl]ethanol.
| Compound Name | 2-[1-(3,4-diaminophenyl)pyrrolidin-3-yl]ethanol |
|---|---|
| PubChem CID | 106751244 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 2-[1-(3,4-diaminophenyl)pyrrolidin-3-yl]ethanol |
| SMILES | Nc1ccc(N2CCC(CCO)C2)cc1N |
| InChI | InChI=1S/C12H19N3O/c13-11-2-1-10(7-12(11)14)15-5-3-9(8-15)4-6-16/h1-2,7,9,16H,3-6,8,13-14H2 |
| InChIKey | SYOXPOMVZIMDIT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|