C14H17F3N2OS — CID 114797684
4-[3-(2-hydroxyethyl)pyrrolidin-1-yl]-2-(trifluoromethyl)benzenecarbothioamide (PubChem CID 114797684) has the molecular formula C14H17F3N2OS and a molecular weight of 318.36 g/mol. Its IUPAC name is 4-[3-(2-hydroxyethyl)pyrrolidin-1-yl]-2-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | 4-[3-(2-hydroxyethyl)pyrrolidin-1-yl]-2-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 114797684 |
| Molecular Formula | C14H17F3N2OS |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 4-[3-(2-hydroxyethyl)pyrrolidin-1-yl]-2-(trifluoromethyl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(N2CCC(CCO)C2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H17F3N2OS/c15-14(16,17)12-7-10(1-2-11(12)13(18)21)19-5-3-9(8-19)4-6-20/h1-2,7,9,20H,3-6,8H2,(H2,18,21) |
| InChIKey | ZZORAZJNNFWDEX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|