C14H18F3N3O — CID 103976783
4-[3-(1-aminoethyl)pyrrolidin-1-yl]-2-(trifluoromethyl)benzamide (PubChem CID 103976783) has the molecular formula C14H18F3N3O and a molecular weight of 301.31 g/mol. Its IUPAC name is 4-[3-(1-aminoethyl)pyrrolidin-1-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | 4-[3-(1-aminoethyl)pyrrolidin-1-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 103976783 |
| Molecular Formula | C14H18F3N3O |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 4-[3-(1-aminoethyl)pyrrolidin-1-yl]-2-(trifluoromethyl)benzamide |
| SMILES | CC(N)C1CCN(c2ccc(C(N)=O)c(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C14H18F3N3O/c1-8(18)9-4-5-20(7-9)10-2-3-11(13(19)21)12(6-10)14(15,16)17/h2-3,6,8-9H,4-5,7,18H2,1H3,(H2,19,21) |
| InChIKey | PUMUJVHZRWQZAR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |