C12H19N3O — CID 106752314
N-(2-aminoethyl)-2-methyl-N-propan-2-ylpyridine-4-carboxamide (PubChem CID 106752314) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-methyl-N-propan-2-ylpyridine-4-carboxamide.
| Compound Name | N-(2-aminoethyl)-2-methyl-N-propan-2-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 106752314 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | N-(2-aminoethyl)-2-methyl-N-propan-2-ylpyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)N(CCN)C(C)C)ccn1 |
| InChI | InChI=1S/C12H19N3O/c1-9(2)15(7-5-13)12(16)11-4-6-14-10(3)8-11/h4,6,8-9H,5,7,13H2,1-3H3 |
| InChIKey | ROXLXZDIPGZIBN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |