C11H17N3O — CID 106752319
N-(4-aminobutan-2-yl)-2-methylpyridine-4-carboxamide (PubChem CID 106752319) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is N-(4-aminobutan-2-yl)-2-methylpyridine-4-carboxamide.
| Compound Name | N-(4-aminobutan-2-yl)-2-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 106752319 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | N-(4-aminobutan-2-yl)-2-methylpyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NC(C)CCN)ccn1 |
| InChI | InChI=1S/C11H17N3O/c1-8(3-5-12)14-11(15)10-4-6-13-9(2)7-10/h4,6-8H,3,5,12H2,1-2H3,(H,14,15) |
| InChIKey | QVGUWGMMUJLWNU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |