C11H14N2O3 — CID 106753807
methyl 2-[(2-methylpyridine-4-carbonyl)amino]propanoate (PubChem CID 106753807) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is methyl 2-[(2-methylpyridine-4-carbonyl)amino]propanoate.
| Compound Name | methyl 2-[(2-methylpyridine-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 106753807 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | methyl 2-[(2-methylpyridine-4-carbonyl)amino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)c1ccnc(C)c1 |
| InChI | InChI=1S/C11H14N2O3/c1-7-6-9(4-5-12-7)10(14)13-8(2)11(15)16-3/h4-6,8H,1-3H3,(H,13,14) |
| InChIKey | HNUZQBRSVUKFCW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |