C11H12N4 — CID 106753267
4-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)-2-methylpyridine (PubChem CID 106753267) has the molecular formula C11H12N4 and a molecular weight of 200.25 g/mol. Its IUPAC name is 4-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)-2-methylpyridine.
| Compound Name | 4-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)-2-methylpyridine |
|---|---|
| PubChem CID | 106753267 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 4-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)-2-methylpyridine |
| SMILES | Cc1cc(-c2n[nH]c(C3CC3)n2)ccn1 |
| InChI | InChI=1S/C11H12N4/c1-7-6-9(4-5-12-7)11-13-10(14-15-11)8-2-3-8/h4-6,8H,2-3H2,1H3,(H,13,14,15) |
| InChIKey | DDOUXJHQLXCHOR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |