C10H12N2O2 — CID 106753340
2-methyl-N-(oxetan-3-yl)pyridine-4-carboxamide (PubChem CID 106753340) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-methyl-N-(oxetan-3-yl)pyridine-4-carboxamide.
| Compound Name | 2-methyl-N-(oxetan-3-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 106753340 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-methyl-N-(oxetan-3-yl)pyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NC2COC2)ccn1 |
| InChI | InChI=1S/C10H12N2O2/c1-7-4-8(2-3-11-7)10(13)12-9-5-14-6-9/h2-4,9H,5-6H2,1H3,(H,12,13) |
| InChIKey | ITKZENVVFPXKSA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |