C9H18N4O2S — CID 106757728
3-[1-(2-methylpyrazol-3-yl)ethylamino]propane-1-sulfonamide (PubChem CID 106757728) has the molecular formula C9H18N4O2S and a molecular weight of 246.34 g/mol. Its IUPAC name is 3-[1-(2-methylpyrazol-3-yl)ethylamino]propane-1-sulfonamide.
| Compound Name | 3-[1-(2-methylpyrazol-3-yl)ethylamino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 106757728 |
| Molecular Formula | C9H18N4O2S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 3-[1-(2-methylpyrazol-3-yl)ethylamino]propane-1-sulfonamide |
| SMILES | CC(NCCCS(N)(=O)=O)c1ccnn1C |
| InChI | InChI=1S/C9H18N4O2S/c1-8(9-4-6-12-13(9)2)11-5-3-7-16(10,14)15/h4,6,8,11H,3,5,7H2,1-2H3,(H2,10,14,15) |
| InChIKey | DTNORLBEYOFGRS-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|